C9H16O3 — CID 100974772
[(3S)-3,5,5-trimethyloxolan-2-yl] acetate (PubChem CID 100974772) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is [(3S)-3,5,5-trimethyloxolan-2-yl] acetate.
| Compound Name | [(3S)-3,5,5-trimethyloxolan-2-yl] acetate |
|---|---|
| PubChem CID | 100974772 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(3S)-3,5,5-trimethyloxolan-2-yl] acetate |
| SMILES | CC(=O)OC1OC(C)(C)C[C@@H]1C |
| InChI | InChI=1S/C9H16O3/c1-6-5-9(3,4)12-8(6)11-7(2)10/h6,8H,5H2,1-4H3/t6-,8?/m0/s1 |
| InChIKey | GJLKELDUCWOVOZ-UUEFVBAFSA-N |
| XLogP | 1.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |