C32H52O3 — CID 162977990
[(3R,4aS,6aR,6aS,8aR,11S,12aR,14aR,14bR)-11-(hydroxymethyl)-4,4,6a,6a,8a,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 162977990) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is [(3R,4aS,6aR,6aS,8aR,11S,12aR,14aR,14bR)-11-(hydroxymethyl)-4,4,6a,6a,8a,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3R,4aS,6aR,6aS,8aR,11S,12aR,14aR,14bR)-11-(hydroxymethyl)-4,4,6a,6a,8a,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 162977990 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | [(3R,4aS,6aR,6aS,8aR,11S,12aR,14aR,14bR)-11-(hydroxymethyl)-4,4,6a,6a,8a,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,10,12,12a,13,14,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@H](CC[C@@]3(C)C4=CC[C@@]5(C)CC[C@](C)(CO)C[C@H]5[C@]4(C)CC[C@H]23)C1(C)C |
| InChI | InChI=1S/C32H52O3/c1-21(34)35-26-12-16-30(6)22(27(26,2)3)10-14-31(7)23-9-13-29(5)18-17-28(4,20-33)19-25(29)32(23,8)15-11-24(30)31/h9,22,24-26,33H,10-20H2,1-8H3/t22-,24-,25-,26-,28+,29+,30+,31+,32-/m1/s1 |
| InChIKey | LGQFGPFPSNYSDG-IUPBPAFFSA-N |
| XLogP | 7.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|