C32H52O2 — CID 162853291
(4,4,6a,6a,8a,11,12,14b-octamethyl-2,3,4a,5,6,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl) acetate (PubChem CID 162853291) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is (4,4,6a,6a,8a,11,12,14b-octamethyl-2,3,4a,5,6,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl) acetate.
| Compound Name | (4,4,6a,6a,8a,11,12,14b-octamethyl-2,3,4a,5,6,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl) acetate |
|---|---|
| PubChem CID | 162853291 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | (4,4,6a,6a,8a,11,12,14b-octamethyl-2,3,4a,5,6,8,9,10,11,12,12a,13,14,14a-tetradecahydro-1H-picen-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4(C)C(=CCC5(C)CCC(C)C(C)C54)C3(C)CCC2C1(C)C |
| InChI | InChI=1S/C32H52O2/c1-20-10-15-29(6)16-11-25-31(8)17-12-23-28(4,5)26(34-22(3)33)14-19-30(23,7)24(31)13-18-32(25,9)27(29)21(20)2/h11,20-21,23-24,26-27H,10,12-19H2,1-9H3 |
| InChIKey | UXSZWTNSCFDGNM-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|