C34H56O4 — CID 538876
(13-acetyloxy-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl) acetate (PubChem CID 538876) has the molecular formula C34H56O4 and a molecular weight of 528.82 g/mol. Its IUPAC name is (13-acetyloxy-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl) acetate.
| Compound Name | (13-acetyloxy-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl) acetate |
|---|---|
| PubChem CID | 538876 |
| Molecular Formula | C34H56O4 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.42 |
| IUPAC Name | (13-acetyloxy-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,6a,7,8,9,10,11,12,12a,13,14,14a-hexadecahydro-1H-picen-3-yl) acetate |
| SMILES | CC(=O)OC1CC2C3(C)CCC(OC(C)=O)C(C)(C)C3CCC2(C)C2(C)CCC3(C)CCC(C)C(C)C3C12 |
| InChI | InChI=1S/C34H56O4/c1-20-11-14-31(7)17-18-34(10)29(28(31)21(20)2)24(37-22(3)35)19-26-32(8)15-13-27(38-23(4)36)30(5,6)25(32)12-16-33(26,34)9/h20-21,24-29H,11-19H2,1-10H3 |
| InChIKey | NGJFMHMWLOMBRH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |