C34H56O6 — CID 91270349
[(3R,8R,10R,12R,14R)-12-acetyloxy-17-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 91270349) has the molecular formula C34H56O6 and a molecular weight of 560.82 g/mol. Its IUPAC name is [(3R,8R,10R,12R,14R)-12-acetyloxy-17-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8R,10R,12R,14R)-12-acetyloxy-17-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 91270349 |
| Molecular Formula | C34H56O6 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | [(3R,8R,10R,12R,14R)-12-acetyloxy-17-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2[C@@]3(C)CC[C@@H](OC(C)=O)C(C)(C)C3CC[C@@]2(C)[C@]2(C)CCC(C(C)(O)CC=CC(C)(C)O)C12 |
| InChI | InChI=1S/C34H56O6/c1-21(35)39-24-20-26-31(7)17-14-27(40-22(2)36)30(5,6)25(31)13-19-32(26,8)33(9)18-12-23(28(24)33)34(10,38)16-11-15-29(3,4)37/h11,15,23-28,37-38H,12-14,16-20H2,1-10H3/t23?,24-,25?,26?,27-,28?,31+,32-,33-,34?/m1/s1 |
| InChIKey | KUAIBSYZVOJUSP-PMQRCFRESA-N |
| XLogP | 6.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|