C33H54O6 — CID 162886909
methyl 3-[4-acetyloxy-3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 162886909) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is methyl 3-[4-acetyloxy-3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-[4-acetyloxy-3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 162886909 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | methyl 3-[4-acetyloxy-3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | C=C(C)C1CCC2(C)C(CC(OC(C)=O)C3C(C(C)(O)CC=CC(C)(C)O)CCC32C)C1(C)CCC(=O)OC |
| InChI | InChI=1S/C33H54O6/c1-21(2)23-12-18-31(7)26(30(23,6)17-14-27(35)38-10)20-25(39-22(3)34)28-24(13-19-32(28,31)8)33(9,37)16-11-15-29(4,5)36/h11,15,23-26,28,36-37H,1,12-14,16-20H2,2-10H3 |
| InChIKey | QCYLSMCCPZUBCM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|