C32H54O4 — CID 162935609
4-[(3R,3aR,5aR,6S,7S,9aR,9bR)-3-[(E,2S)-2-hydroxy-6-methoxy-6-methylhept-4-en-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid (PubChem CID 162935609) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is 4-[(3R,3aR,5aR,6S,7S,9aR,9bR)-3-[(E,2S)-2-hydroxy-6-methoxy-6-methylhept-4-en-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid.
| Compound Name | 4-[(3R,3aR,5aR,6S,7S,9aR,9bR)-3-[(E,2S)-2-hydroxy-6-methoxy-6-methylhept-4-en-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid |
|---|---|
| PubChem CID | 162935609 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | 4-[(3R,3aR,5aR,6S,7S,9aR,9bR)-3-[(E,2S)-2-hydroxy-6-methoxy-6-methylhept-4-en-2-yl]-6,9a,9b-trimethyl-7-prop-1-en-2-yl-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]butanoic acid |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)[C@H](CC[C@@H]3[C@H]([C@@](C)(O)C/C=C/C(C)(C)OC)CC[C@]32C)[C@@]1(C)CCCC(=O)O |
| InChI | InChI=1S/C32H54O4/c1-22(2)23-15-21-31(7)26(29(23,5)18-10-12-27(33)34)14-13-24-25(16-20-30(24,31)6)32(8,35)19-11-17-28(3,4)36-9/h11,17,23-26,35H,1,10,12-16,18-21H2,2-9H3,(H,33,34)/b17-11+/t23-,24+,25+,26+,29-,30+,31+,32-/m0/s1 |
| InChIKey | GOAOGTWJCVZTQM-CNPOMQENSA-N |
| XLogP | 7.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|