C36H60O9 — CID 73321057
3-[3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid (PubChem CID 73321057) has the molecular formula C36H60O9 and a molecular weight of 636.87 g/mol. Its IUPAC name is 3-[3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid.
| Compound Name | 3-[3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid |
|---|---|
| PubChem CID | 73321057 |
| Molecular Formula | C36H60O9 |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | 3-[3-(2,6-dihydroxy-6-methylhept-4-en-2-yl)-6,9a,9b-trimethyl-7-prop-1-en-2-yl-4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-1,2,3,3a,4,5,5a,7,8,9-decahydrocyclopenta[a]naphthalen-6-yl]propanoic acid |
| SMILES | C=C(C)C1CCC2(C)C(CC(OC3OC(C)C(O)C(O)C3O)C3C(C(C)(O)CC=CC(C)(C)O)CCC32C)C1(C)CCC(=O)O |
| InChI | InChI=1S/C36H60O9/c1-20(2)22-11-17-34(7)25(33(22,6)16-13-26(37)38)19-24(45-31-30(41)29(40)28(39)21(3)44-31)27-23(12-18-35(27,34)8)36(9,43)15-10-14-32(4,5)42/h10,14,21-25,27-31,39-43H,1,11-13,15-19H2,2-9H3,(H,37,38) |
| InChIKey | NNXQSUSEFPRCRS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|