C35H56O7 — CID 58590924
[(3R)-12-acetyloxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-formyloxyacetate (PubChem CID 58590924) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is [(3R)-12-acetyloxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-formyloxyacetate.
| Compound Name | [(3R)-12-acetyloxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-formyloxyacetate |
|---|---|
| PubChem CID | 58590924 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | [(3R)-12-acetyloxy-17-(2-hydroxy-6-methylhept-5-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-formyloxyacetate |
| SMILES | CC(=O)OC1CC2C3(C)CC[C@@H](OC(=O)COC=O)C(C)(C)C3CCC2(C)C2(C)CCC(C(C)(O)CCC=C(C)C)C12 |
| InChI | InChI=1S/C35H56O7/c1-22(2)11-10-15-35(9,39)24-12-17-34(8)30(24)25(41-23(3)37)19-27-32(6)16-14-28(42-29(38)20-40-21-36)31(4,5)26(32)13-18-33(27,34)7/h11,21,24-28,30,39H,10,12-20H2,1-9H3/t24?,25?,26?,27?,28-,30?,32?,33?,34?,35?/m1/s1 |
| InChIKey | JGRLUWNTZRERQI-SHKKYPSMSA-N |
| XLogP | 6.80 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|