C34H54O4 — CID 162936655
(9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl) acetate (PubChem CID 162936655) has the molecular formula C34H54O4 and a molecular weight of 526.80 g/mol. Its IUPAC name is (9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl) acetate.
| Compound Name | (9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl) acetate |
|---|---|
| PubChem CID | 162936655 |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | (9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,6a,7,8,9,10,12,12a,14a-tetradecahydropicen-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2C=CC2C4CC(C)(C)CC(OC(C)=O)C4(C)CCC23C)C1(C)C |
| InChI | InChI=1S/C34H54O4/c1-21(35)37-27-14-15-32(8)25(30(27,5)6)13-16-34(10)26(32)12-11-23-24-19-29(3,4)20-28(38-22(2)36)31(24,7)17-18-33(23,34)9/h11-12,23-28H,13-20H2,1-10H3 |
| InChIKey | XHTLPCFXXLKRRU-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|