C36H54O6 — CID 95796275
[(2R,4R,4aR,6aS,6aS,6bR,8aR,10R,12aS)-4,10-diacetyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl acetate (PubChem CID 95796275) has the molecular formula C36H54O6 and a molecular weight of 582.82 g/mol. Its IUPAC name is [(2R,4R,4aR,6aS,6aS,6bR,8aR,10R,12aS)-4,10-diacetyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl acetate.
| Compound Name | [(2R,4R,4aR,6aS,6aS,6bR,8aR,10R,12aS)-4,10-diacetyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 95796275 |
| Molecular Formula | C36H54O6 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.39 |
| IUPAC Name | [(2R,4R,4aR,6aS,6aS,6bR,8aR,10R,12aS)-4,10-diacetyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(C)CC2=C3C=C[C@H]4[C@@]5(C)CC[C@@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C36H54O6/c1-22(37)40-21-32(6)19-26-25-11-12-28-34(8)15-14-29(41-23(2)38)31(4,5)27(34)13-16-36(28,10)35(25,9)18-17-33(26,7)30(20-32)42-24(3)39/h11-12,27-30H,13-21H2,1-10H3/t27-,28-,29+,30+,32+,33+,34-,35+,36+/m0/s1 |
| InChIKey | UZZHVJKMMASYGM-CZWFXPJYSA-N |
| XLogP | 7.74 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|