C36H56O6 — CID 15382798
[(4aS,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5,10-diacetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate (PubChem CID 15382798) has the molecular formula C36H56O6 and a molecular weight of 584.84 g/mol. Its IUPAC name is [(4aS,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5,10-diacetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate.
| Compound Name | [(4aS,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5,10-diacetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 15382798 |
| Molecular Formula | C36H56O6 |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | [(4aS,5S,6aR,6aS,6bR,8aR,10S,12aR,14bS)-5,10-diacetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@@H]2OC(C)=O |
| InChI | InChI=1S/C36H56O6/c1-22(37)40-21-36-18-17-31(4,5)19-26(36)25-11-12-28-33(8)15-14-29(41-23(2)38)32(6,7)27(33)13-16-34(28,9)35(25,10)20-30(36)42-24(3)39/h11,26-30H,12-21H2,1-10H3/t26-,27-,28+,29-,30-,33-,34+,35+,36+/m0/s1 |
| InChIKey | PDSQZLWIMADWQX-UFPXGYACSA-N |
| XLogP | 7.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|