C34H55NO4 — CID 123873936
[8a-(2-hydroxyethylcarbamoyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 123873936) has the molecular formula C34H55NO4 and a molecular weight of 541.82 g/mol. Its IUPAC name is [8a-(2-hydroxyethylcarbamoyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [8a-(2-hydroxyethylcarbamoyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 123873936 |
| Molecular Formula | C34H55NO4 |
| Molecular Weight | 541.82 g/mol |
| Exact Mass | 541.41 |
| IUPAC Name | [8a-(2-hydroxyethylcarbamoyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C(=O)NCCO)CCC23C)C1(C)C |
| InChI | InChI=1S/C34H55NO4/c1-22(37)39-27-12-13-31(6)25(30(27,4)5)11-14-33(8)26(31)10-9-23-24-21-29(2,3)15-17-34(24,18-16-32(23,33)7)28(38)35-19-20-36/h9,24-27,36H,10-21H2,1-8H3,(H,35,38) |
| InChIKey | QPMUOIMBGVNTFJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.82 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|