C36H60N2O3 — CID 98551772
[(3R,4aS,6aR,6bR,8aS,12aR,14aR,14bS)-8a-[2-(dimethylamino)ethylcarbamoyl]-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 98551772) has the molecular formula C36H60N2O3 and a molecular weight of 568.89 g/mol. Its IUPAC name is [(3R,4aS,6aR,6bR,8aS,12aR,14aR,14bS)-8a-[2-(dimethylamino)ethylcarbamoyl]-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3R,4aS,6aR,6bR,8aS,12aR,14aR,14bS)-8a-[2-(dimethylamino)ethylcarbamoyl]-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 98551772 |
| Molecular Formula | C36H60N2O3 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.46 |
| IUPAC Name | [(3R,4aS,6aR,6bR,8aS,12aR,14aR,14bS)-8a-[2-(dimethylamino)ethylcarbamoyl]-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)[C@H](CC[C@]3(C)[C@@H]2CC=C2[C@H]4CC(C)(C)CC[C@]4(C(=O)NCCN(C)C)CC[C@@]23C)C1(C)C |
| InChI | InChI=1S/C36H60N2O3/c1-24(39)41-29-14-15-33(6)27(32(29,4)5)13-16-35(8)28(33)12-11-25-26-23-31(2,3)17-19-36(26,20-18-34(25,35)7)30(40)37-21-22-38(9)10/h11,26-29H,12-23H2,1-10H3,(H,37,40)/t26-,27-,28-,29-,33-,34+,35-,36+/m1/s1 |
| InChIKey | XMEBYGAEVAMHEQ-SGWVKILESA-N |
| XLogP | 7.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|