C34H51N3O5 — CID 124542524
methyl (2S,4E,4aR,6aR,6aR,6bR,8aR,10S,12aS)-10-acetyloxy-4-(carbamoylhydrazinylidene)-2,4a,6a,6b,9,9,12a-heptamethyl-3,5,6,6a,7,8,8a,10,11,12-decahydro-1H-picene-2-carboxylate (PubChem CID 124542524) has the molecular formula C34H51N3O5 and a molecular weight of 581.80 g/mol. Its IUPAC name is methyl (2S,4E,4aR,6aR,6aR,6bR,8aR,10S,12aS)-10-acetyloxy-4-(carbamoylhydrazinylidene)-2,4a,6a,6b,9,9,12a-heptamethyl-3,5,6,6a,7,8,8a,10,11,12-decahydro-1H-picene-2-carboxylate.
| Compound Name | methyl (2S,4E,4aR,6aR,6aR,6bR,8aR,10S,12aS)-10-acetyloxy-4-(carbamoylhydrazinylidene)-2,4a,6a,6b,9,9,12a-heptamethyl-3,5,6,6a,7,8,8a,10,11,12-decahydro-1H-picene-2-carboxylate |
|---|---|
| PubChem CID | 124542524 |
| Molecular Formula | C34H51N3O5 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.38 |
| IUPAC Name | methyl (2S,4E,4aR,6aR,6aR,6bR,8aR,10S,12aS)-10-acetyloxy-4-(carbamoylhydrazinylidene)-2,4a,6a,6b,9,9,12a-heptamethyl-3,5,6,6a,7,8,8a,10,11,12-decahydro-1H-picene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC2=C3C=C[C@@H]4[C@@]5(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]5CC[C@@]4(C)[C@@]3(C)CC[C@@]2(C)/C(=N/NC(N)=O)C1 |
| InChI | InChI=1S/C34H51N3O5/c1-20(38)42-26-13-14-32(6)23(29(26,2)3)12-15-34(8)24(32)11-10-21-22-18-30(4,27(39)41-9)19-25(36-37-28(35)40)31(22,5)16-17-33(21,34)7/h10-11,23-24,26H,12-19H2,1-9H3,(H3,35,37,40)/b36-25+/t23-,24+,26-,30-,31+,32-,33-,34+/m0/s1 |
| InChIKey | UEHPPJREDWXIJQ-RDLHTGMASA-N |
| XLogP | 6.45 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|