C44H56O4 — CID 10009439
[(2S,6aS)-10-benzoyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl benzoate (PubChem CID 10009439) has the molecular formula C44H56O4 and a molecular weight of 648.93 g/mol. Its IUPAC name is [(2S,6aS)-10-benzoyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl benzoate.
| Compound Name | [(2S,6aS)-10-benzoyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10009439 |
| Molecular Formula | C44H56O4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | [(2S,6aS)-10-benzoyloxy-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12-dodecahydropicen-2-yl]methyl benzoate |
| SMILES | CC12CC[C@](C)(COC(=O)c3ccccc3)CC1=C1C=CC3C4(C)CCC(OC(=O)c5ccccc5)C(C)(C)C4CCC3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C44H56O4/c1-39(2)34-20-23-44(7)35(42(34,5)22-21-36(39)48-38(46)31-16-12-9-13-17-31)19-18-32-33-28-40(3,24-25-41(33,4)26-27-43(32,44)6)29-47-37(45)30-14-10-8-11-15-30/h8-19,34-36H,20-29H2,1-7H3/t34?,35?,36?,40-,41?,42?,43+,44?/m0/s1 |
| InChIKey | MVDZLLIXAQJZPH-JQTXPKMCSA-N |
| XLogP | 10.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |