C42H70O8 — CID 15470727
diethyl (1R,2R,3S,6R)-3,6-bis[[(1S,2R,3S,4R)-3-(2,2-dimethylpropoxy)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 15470727) has the molecular formula C42H70O8 and a molecular weight of 703.01 g/mol. Its IUPAC name is diethyl (1R,2R,3S,6R)-3,6-bis[[(1S,2R,3S,4R)-3-(2,2-dimethylpropoxy)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | diethyl (1R,2R,3S,6R)-3,6-bis[[(1S,2R,3S,4R)-3-(2,2-dimethylpropoxy)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15470727 |
| Molecular Formula | C42H70O8 |
| Molecular Weight | 703.01 g/mol |
| Exact Mass | 702.51 |
| IUPAC Name | diethyl (1R,2R,3S,6R)-3,6-bis[[(1S,2R,3S,4R)-3-(2,2-dimethylpropoxy)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](C(=O)OCC)[C@H](O[C@@H]2[C@H]3CC[C@@](C)([C@@H]2OCC(C)(C)C)C3(C)C)C=C[C@@H]1O[C@@H]1[C@H]2CC[C@@](C)([C@@H]1OCC(C)(C)C)C2(C)C |
| InChI | InChI=1S/C42H70O8/c1-15-45-35(43)29-27(49-31-25-19-21-41(13,39(25,9)10)33(31)47-23-37(3,4)5)17-18-28(30(29)36(44)46-16-2)50-32-26-20-22-42(14,40(26,11)12)34(32)48-24-38(6,7)8/h17-18,25-34H,15-16,19-24H2,1-14H3/t25-,26-,27-,28+,29+,30+,31-,32-,33-,34-,41+,42+/m1/s1 |
| InChIKey | JQOWWVBBKPJPSY-JOCWPYSPSA-N |
| XLogP | 8.20 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.01 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|