C10H21ClN2 — CID 119056746
[(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanamine;hydrochloride (PubChem CID 119056746) has the molecular formula C10H21ClN2 and a molecular weight of 204.74 g/mol. Its IUPAC name is [(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanamine;hydrochloride.
| Compound Name | [(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 119056746 |
| Molecular Formula | C10H21ClN2 |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | [(9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C10H20N2.ClH/c11-8-9-4-3-7-12-6-2-1-5-10(9)12;/h9-10H,1-8,11H2;1H/t9?,10-;/m1./s1 |
| InChIKey | LAGDTPPZKWZXDS-FJYJDOHQSA-N |
| XLogP | 1.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |