C14H16N2O3S — CID 91682943
(E)-3-[3-(butanoylcarbamothioylamino)phenyl]prop-2-enoic acid (PubChem CID 91682943) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (E)-3-[3-(butanoylcarbamothioylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(butanoylcarbamothioylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 91682943 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (E)-3-[3-(butanoylcarbamothioylamino)phenyl]prop-2-enoic acid |
| SMILES | CCCC(=O)NC(=S)Nc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-4-12(17)16-14(20)15-11-6-3-5-10(9-11)7-8-13(18)19/h3,5-9H,2,4H2,1H3,(H,18,19)(H2,15,16,17,20)/b8-7+ |
| InChIKey | UWRPUWRIYNJPIF-BQYQJAHWSA-N |
| XLogP | 2.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|