C13H16N2O3 — CID 115339757
(E)-3-[3-(4-aminobutanoylamino)phenyl]prop-2-enoic acid (PubChem CID 115339757) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (E)-3-[3-(4-aminobutanoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(4-aminobutanoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115339757 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (E)-3-[3-(4-aminobutanoylamino)phenyl]prop-2-enoic acid |
| SMILES | NCCCC(=O)Nc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O3/c14-8-2-5-12(16)15-11-4-1-3-10(9-11)6-7-13(17)18/h1,3-4,6-7,9H,2,5,8,14H2,(H,15,16)(H,17,18)/b7-6+ |
| InChIKey | GVKZTCJNVTVVDH-VOTSOKGWSA-N |
| XLogP | 1.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|