C20H21NO9 — CID 56669926
(E)-4-[5-(2-nitrophenyl)furan-2-yl]-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one (PubChem CID 56669926) has the molecular formula C20H21NO9 and a molecular weight of 419.39 g/mol. Its IUPAC name is (E)-4-[5-(2-nitrophenyl)furan-2-yl]-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one.
| Compound Name | (E)-4-[5-(2-nitrophenyl)furan-2-yl]-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 56669926 |
| Molecular Formula | C20H21NO9 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (E)-4-[5-(2-nitrophenyl)furan-2-yl]-1-[(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]but-3-en-2-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2[N+](=O)[O-])o1)C[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H21NO9/c22-10-17-19(25)20(26)18(24)16(30-17)9-11(23)5-6-12-7-8-15(29-12)13-3-1-2-4-14(13)21(27)28/h1-8,16-20,22,24-26H,9-10H2/b6-5+/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | BRLGISGSYWIJIR-YWUQKTNQSA-N |
| XLogP | 0.67 |
| TPSA | 163.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|