C8H15N5O6 — CID 132933564
2-azido-N'-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]acetohydrazide (PubChem CID 132933564) has the molecular formula C8H15N5O6 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2-azido-N'-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]acetohydrazide.
| Compound Name | 2-azido-N'-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 132933564 |
| Molecular Formula | C8H15N5O6 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-azido-N'-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]acetohydrazide |
| SMILES | [N-]=[N+]=NCC(=O)NNC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15N5O6/c9-13-10-1-4(15)11-12-8-7(18)6(17)5(16)3(2-14)19-8/h3,5-8,12,14,16-18H,1-2H2,(H,11,15)/t3-,5+,6+,7-,8?/m1/s1 |
| InChIKey | LUGJTJNQLHNDNR-SUVUXTLLSA-N |
| XLogP | -3.28 |
| TPSA | 180.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|