C7H14N4O5 — CID 58400267
1-(diaminomethylidene)-3-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea (PubChem CID 58400267) has the molecular formula C7H14N4O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
|---|---|
| PubChem CID | 58400267 |
| Molecular Formula | C7H14N4O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(diaminomethylidene)-3-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
| SMILES | NC(N)=NC(=O)N[C@@H]1O[C@H](CO)[C@H](O)C1O |
| InChI | InChI=1S/C7H14N4O5/c8-6(9)11-7(15)10-5-4(14)3(13)2(1-12)16-5/h2-5,12-14H,1H2,(H5,8,9,10,11,15)/t2-,3+,4?,5-/m1/s1 |
| InChIKey | KSNSQOVBNYYHLW-YQWWZGPCSA-N |
| XLogP | -3.59 |
| TPSA | 163.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|