C18H25N5O6S — CID 6481972
1-[4-(3-propoxy-1,2,4-triazol-1-yl)phenyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea (PubChem CID 6481972) has the molecular formula C18H25N5O6S and a molecular weight of 439.49 g/mol. Its IUPAC name is 1-[4-(3-propoxy-1,2,4-triazol-1-yl)phenyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea.
| Compound Name | 1-[4-(3-propoxy-1,2,4-triazol-1-yl)phenyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
|---|---|
| PubChem CID | 6481972 |
| Molecular Formula | C18H25N5O6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[4-(3-propoxy-1,2,4-triazol-1-yl)phenyl]-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiourea |
| SMILES | CCCOc1ncn(-c2ccc(NC(=S)NC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)n1 |
| InChI | InChI=1S/C18H25N5O6S/c1-2-7-28-17-19-9-23(22-17)11-5-3-10(4-6-11)20-18(30)21-16-15(27)14(26)13(25)12(8-24)29-16/h3-6,9,12-16,24-27H,2,7-8H2,1H3,(H2,20,21,30)/t12-,13-,14+,15-,16?/m1/s1 |
| InChIKey | KCNQGFOWVIQTJP-IWQYDBTJSA-N |
| XLogP | -0.86 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|