C14H19IO5 — CID 3336704
2-(4-ethylphenoxy)-6-(iodomethyl)oxane-3,4,5-triol (PubChem CID 3336704) has the molecular formula C14H19IO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-6-(iodomethyl)oxane-3,4,5-triol.
| Compound Name | 2-(4-ethylphenoxy)-6-(iodomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 3336704 |
| Molecular Formula | C14H19IO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-(4-ethylphenoxy)-6-(iodomethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(OC2OC(CI)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C14H19IO5/c1-2-8-3-5-9(6-4-8)19-14-13(18)12(17)11(16)10(7-15)20-14/h3-6,10-14,16-18H,2,7H2,1H3 |
| InChIKey | PFDIEUBGGCGHPN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|