C12H14BrIO5 — CID 51443454
(2R,3R,4R,5S,6R)-2-(4-bromophenoxy)-6-(iodomethyl)oxane-3,4,5-triol (PubChem CID 51443454) has the molecular formula C12H14BrIO5 and a molecular weight of 445.05 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-(4-bromophenoxy)-6-(iodomethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6R)-2-(4-bromophenoxy)-6-(iodomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 51443454 |
| Molecular Formula | C12H14BrIO5 |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 443.91 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-(4-bromophenoxy)-6-(iodomethyl)oxane-3,4,5-triol |
| SMILES | O[C@H]1[C@@H](O)[C@@H](Oc2ccc(Br)cc2)O[C@@H](CI)[C@H]1O |
| InChI | InChI=1S/C12H14BrIO5/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,15-17H,5H2/t8-,9+,10+,11+,12-/m0/s1 |
| InChIKey | KMKUGSBGWATLAO-KQSJRHEJSA-N |
| XLogP | 1.07 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|