C12H13NNa2O14S2 — CID 102333050
disodium;[(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-(4-nitrophenoxy)-6-(sulfonatooxymethyl)oxan-3-yl] sulfate (PubChem CID 102333050) has the molecular formula C12H13NNa2O14S2 and a molecular weight of 505.34 g/mol. Its IUPAC name is disodium;[(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-(4-nitrophenoxy)-6-(sulfonatooxymethyl)oxan-3-yl] sulfate.
| Compound Name | disodium;[(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-(4-nitrophenoxy)-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
|---|---|
| PubChem CID | 102333050 |
| Molecular Formula | C12H13NNa2O14S2 |
| Molecular Weight | 505.34 g/mol |
| Exact Mass | 504.96 |
| IUPAC Name | disodium;[(2R,3R,4S,5S,6R)-4,5-dihydroxy-2-(4-nitrophenoxy)-6-(sulfonatooxymethyl)oxan-3-yl] sulfate |
| SMILES | O=[N+]([O-])c1ccc(O[C@H]2O[C@H](COS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]2OS(=O)(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C12H15NO14S2.2Na/c14-9-8(5-24-28(18,19)20)26-12(11(10(9)15)27-29(21,22)23)25-7-3-1-6(2-4-7)13(16)17;;/h1-4,8-12,14-15H,5H2,(H,18,19,20)(H,21,22,23);;/q;2*+1/p-2/t8-,9-,10+,11-,12+;;/m1../s1 |
| InChIKey | VGFFLPKVTGLBOB-YXPRYHTJSA-L |
| XLogP | -8.25 |
| TPSA | 234.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.34 |
| LogP ≤ 5 | -8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|