C14H17KN2O11S — CID 50909627
potassium [5-acetamido-3,4-dihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate (PubChem CID 50909627) has the molecular formula C14H17KN2O11S and a molecular weight of 460.46 g/mol. Its IUPAC name is potassium [5-acetamido-3,4-dihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate.
| Compound Name | potassium [5-acetamido-3,4-dihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 50909627 |
| Molecular Formula | C14H17KN2O11S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | potassium [5-acetamido-3,4-dihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate |
| SMILES | CC(=O)NC1C(Oc2ccc([N+](=O)[O-])cc2)OC(COS(=O)(=O)[O-])C(O)C1O.[K+] |
| InChI | InChI=1S/C14H18N2O11S.K/c1-7(17)15-11-13(19)12(18)10(6-25-28(22,23)24)27-14(11)26-9-4-2-8(3-5-9)16(20)21;/h2-5,10-14,18-19H,6H2,1H3,(H,15,17)(H,22,23,24);/q;+1/p-1 |
| InChIKey | OWFVRPVXAZQCAE-UHFFFAOYSA-M |
| XLogP | -4.59 |
| TPSA | 197.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|