C22H31N3O16S — CID 102152595
[(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3S,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl hydrogen sulfate (PubChem CID 102152595) has the molecular formula C22H31N3O16S and a molecular weight of 625.56 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3S,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3S,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 102152595 |
| Molecular Formula | C22H31N3O16S |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-6-[(2R,3S,4R,5R,6R)-5-acetamido-4-hydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-3,4-dihydroxyoxan-2-yl]methyl hydrogen sulfate |
| SMILES | CC(=O)N[C@H]1[C@@H](Oc2ccc([N+](=O)[O-])cc2)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@@H]1O |
| InChI | InChI=1S/C22H31N3O16S/c1-9(27)23-15-18(30)17(29)14(8-37-42(34,35)36)40-22(15)41-20-13(7-26)39-21(16(19(20)31)24-10(2)28)38-12-5-3-11(4-6-12)25(32)33/h3-6,13-22,26,29-31H,7-8H2,1-2H3,(H,23,27)(H,24,28)(H,34,35,36)/t13-,14-,15-,16-,17-,18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | SROMKEBHWHMEKM-SQHJLSENSA-N |
| XLogP | -3.29 |
| TPSA | 282.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|