C12H14NNaO11S — CID 101339304
sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate (PubChem CID 101339304) has the molecular formula C12H14NNaO11S and a molecular weight of 403.30 g/mol. Its IUPAC name is sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate.
| Compound Name | sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate |
|---|---|
| PubChem CID | 101339304 |
| Molecular Formula | C12H14NNaO11S |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | sodium [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methyl sulfate |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](COS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)cc1.[Na+] |
| InChI | InChI=1S/C12H15NO11S.Na/c14-9-8(5-22-25(19,20)21)24-12(11(16)10(9)15)23-7-3-1-6(2-4-7)13(17)18;/h1-4,8-12,14-16H,5H2,(H,19,20,21);/q;+1/p-1/t8-,9-,10+,11-,12-;/m1./s1 |
| InChIKey | ZMOQXKUZRXJQHA-ZIJVCQRQSA-M |
| XLogP | -4.74 |
| TPSA | 188.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|