C15H18N6O7 — CID 135452371
[4-acetyloxy-3-[methyl(nitroso)amino]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (PubChem CID 135452371) has the molecular formula C15H18N6O7 and a molecular weight of 394.34 g/mol. Its IUPAC name is [4-acetyloxy-3-[methyl(nitroso)amino]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-3-[methyl(nitroso)amino]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135452371 |
| Molecular Formula | C15H18N6O7 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [4-acetyloxy-3-[methyl(nitroso)amino]-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2cnc3c(=O)[nH]cnc32)C(OC(C)=O)C1N(C)N=O |
| InChI | InChI=1S/C15H18N6O7/c1-7(22)26-4-9-11(20(3)19-25)12(27-8(2)23)15(28-9)21-6-18-10-13(21)16-5-17-14(10)24/h5-6,9,11-12,15H,4H2,1-3H3,(H,16,17,24) |
| InChIKey | BAAVJINXSIYPIT-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|