C22H29N5O7S — CID 11477684
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(cyclohexylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 11477684) has the molecular formula C22H29N5O7S and a molecular weight of 507.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(cyclohexylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(cyclohexylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11477684 |
| Molecular Formula | C22H29N5O7S |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[8-(cyclohexylamino)-6-sulfanylidene-3H-purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2c(NC3CCCCC3)nc3c(=S)nc[nH]c32)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H29N5O7S/c1-11(28)31-9-15-17(32-12(2)29)18(33-13(3)30)21(34-15)27-19-16(20(35)24-10-23-19)26-22(27)25-14-7-5-4-6-8-14/h10,14-15,17-18,21H,4-9H2,1-3H3,(H,25,26)(H,23,24,35)/t15-,17-,18-,21-/m1/s1 |
| InChIKey | DFXXRLRVUDWFPY-QTQZEZTPSA-N |
| XLogP | 2.56 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|