C12H21NO6 — CID 160728842
(6S,7S)-5,6-dihydroxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;ethanol;methane (PubChem CID 160728842) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is (6S,7S)-5,6-dihydroxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;ethanol;methane.
| Compound Name | (6S,7S)-5,6-dihydroxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;ethanol;methane |
|---|---|
| PubChem CID | 160728842 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (6S,7S)-5,6-dihydroxy-2-methyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione;ethanol;methane |
| SMILES | C.CCO.CN1C(=O)C2C3O[C@@H](C2C1=O)[C@@H](O)C3O |
| InChI | InChI=1S/C9H11NO5.C2H6O.CH4/c1-10-8(13)2-3(9(10)14)7-5(12)4(11)6(2)15-7;1-2-3;/h2-7,11-12H,1H3;3H,2H2,1H3;1H4/t2?,3?,4-,5?,6-,7?;;/m0../s1 |
| InChIKey | RUBJEHOLZMYNCH-DUJMOCGJSA-N |
| XLogP | -1.65 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|