C14H21NO7 — CID 91501066
(1,2,5-trihydroxy-4-pentanoyloxypyrrol-3-yl) pentanoate (PubChem CID 91501066) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is (1,2,5-trihydroxy-4-pentanoyloxypyrrol-3-yl) pentanoate.
| Compound Name | (1,2,5-trihydroxy-4-pentanoyloxypyrrol-3-yl) pentanoate |
|---|---|
| PubChem CID | 91501066 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (1,2,5-trihydroxy-4-pentanoyloxypyrrol-3-yl) pentanoate |
| SMILES | CCCCC(=O)Oc1c(OC(=O)CCCC)c(O)n(O)c1O |
| InChI | InChI=1S/C14H21NO7/c1-3-5-7-9(16)21-11-12(14(19)15(20)13(11)18)22-10(17)8-6-4-2/h18-20H,3-8H2,1-2H3 |
| InChIKey | JEKWGCWYHAPSJQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|