C20H23ClN4O4S — CID 54567881
[3-(2-chloroethyl)phenyl] [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] carbonate (PubChem CID 54567881) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is [3-(2-chloroethyl)phenyl] [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] carbonate.
| Compound Name | [3-(2-chloroethyl)phenyl] [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] carbonate |
|---|---|
| PubChem CID | 54567881 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [3-(2-chloroethyl)phenyl] [3-(5-cyclobutyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] carbonate |
| SMILES | CN1CCC(OC(=O)Oc2cccc(CCCl)c2)N(c2nnc(C3CCC3)s2)C1=O |
| InChI | InChI=1S/C20H23ClN4O4S/c1-24-11-9-16(29-20(27)28-15-7-2-4-13(12-15)8-10-21)25(19(24)26)18-23-22-17(30-18)14-5-3-6-14/h2,4,7,12,14,16H,3,5-6,8-11H2,1H3 |
| InChIKey | ZVCYESRDDQMSQO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|