C22H34N2O4 — CID 174193096
3-[(4-decylphenyl)carbamoyloxy]pyrrolidine-1-carboxylic acid (PubChem CID 174193096) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 3-[(4-decylphenyl)carbamoyloxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[(4-decylphenyl)carbamoyloxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174193096 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 3-[(4-decylphenyl)carbamoyloxy]pyrrolidine-1-carboxylic acid |
| SMILES | CCCCCCCCCCc1ccc(NC(=O)OC2CCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C22H34N2O4/c1-2-3-4-5-6-7-8-9-10-18-11-13-19(14-12-18)23-21(25)28-20-15-16-24(17-20)22(26)27/h11-14,20H,2-10,15-17H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | PWPJPVAEMIVARI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|