C19H30N2O — CID 4231179
1-cyclohexyl-3-(4-hexylphenyl)urea (PubChem CID 4231179) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-hexylphenyl)urea.
| Compound Name | 1-cyclohexyl-3-(4-hexylphenyl)urea |
|---|---|
| PubChem CID | 4231179 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-cyclohexyl-3-(4-hexylphenyl)urea |
| SMILES | CCCCCCc1ccc(NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O/c1-2-3-4-6-9-16-12-14-18(15-13-16)21-19(22)20-17-10-7-5-8-11-17/h12-15,17H,2-11H2,1H3,(H2,20,21,22) |
| InChIKey | JMNUIXYTYDXDFM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|