C24H38F3N3O3 — CID 68847192
1-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(4-octylphenyl)urea;2,2,2-trifluoroacetate (PubChem CID 68847192) has the molecular formula C24H38F3N3O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 1-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(4-octylphenyl)urea;2,2,2-trifluoroacetate.
| Compound Name | 1-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(4-octylphenyl)urea;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68847192 |
| Molecular Formula | C24H38F3N3O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 1-(1,1-dimethylpiperidin-1-ium-4-yl)-3-(4-octylphenyl)urea;2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCc1ccc(NC(=O)NC2CC[N+](C)(C)CC2)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H37N3O.C2HF3O2/c1-4-5-6-7-8-9-10-19-11-13-20(14-12-19)23-22(26)24-21-15-17-25(2,3)18-16-21;3-2(4,5)1(6)7/h11-14,21H,4-10,15-18H2,1-3H3,(H-,23,24,26);(H,6,7) |
| InChIKey | KIMDVLZPGJOBDS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|