C23H38N3O2+ — CID 58109942
1-[3-(2-hydroxyprop-2-enyl)-1,1-dimethylazetidin-1-ium-3-yl]-3-(4-octylphenyl)urea (PubChem CID 58109942) has the molecular formula C23H38N3O2+ and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-[3-(2-hydroxyprop-2-enyl)-1,1-dimethylazetidin-1-ium-3-yl]-3-(4-octylphenyl)urea.
| Compound Name | 1-[3-(2-hydroxyprop-2-enyl)-1,1-dimethylazetidin-1-ium-3-yl]-3-(4-octylphenyl)urea |
|---|---|
| PubChem CID | 58109942 |
| Molecular Formula | C23H38N3O2+ |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 1-[3-(2-hydroxyprop-2-enyl)-1,1-dimethylazetidin-1-ium-3-yl]-3-(4-octylphenyl)urea |
| SMILES | C=C(O)CC1(NC(=O)Nc2ccc(CCCCCCCC)cc2)C[N+](C)(C)C1 |
| InChI | InChI=1S/C23H37N3O2/c1-5-6-7-8-9-10-11-20-12-14-21(15-13-20)24-22(28)25-23(16-19(2)27)17-26(3,4)18-23/h12-15H,2,5-11,16-18H2,1,3-4H3,(H2-,24,25,27,28)/p+1 |
| InChIKey | DTDDRBCGFLTGJZ-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|