C25H37F3N3O4+ — CID 87183333
[2-[1,1-dimethyl-3-[(4-octylphenyl)carbamoylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87183333) has the molecular formula C25H37F3N3O4+ and a molecular weight of 500.58 g/mol. Its IUPAC name is [2-[1,1-dimethyl-3-[(4-octylphenyl)carbamoylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[1,1-dimethyl-3-[(4-octylphenyl)carbamoylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87183333 |
| Molecular Formula | C25H37F3N3O4+ |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | [2-[1,1-dimethyl-3-[(4-octylphenyl)carbamoylamino]pyrrolidin-1-ium-3-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCCCCc1ccc(NC(=O)NC2(CC(=O)OC(=O)C(F)(F)F)CC[N+](C)(C)C2)cc1 |
| InChI | InChI=1S/C25H36F3N3O4/c1-4-5-6-7-8-9-10-19-11-13-20(14-12-19)29-23(34)30-24(15-16-31(2,3)18-24)17-21(32)35-22(33)25(26,27)28/h11-14H,4-10,15-18H2,1-3H3,(H-,29,30,34)/p+1 |
| InChIKey | LYFHTKUWYPLHBE-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|