C21H35N2O+ — CID 71030102
1-[1,1-dimethyl-4-(4-pentylanilino)piperidin-1-ium-4-yl]propan-2-one (PubChem CID 71030102) has the molecular formula C21H35N2O+ and a molecular weight of 331.52 g/mol. Its IUPAC name is 1-[1,1-dimethyl-4-(4-pentylanilino)piperidin-1-ium-4-yl]propan-2-one.
| Compound Name | 1-[1,1-dimethyl-4-(4-pentylanilino)piperidin-1-ium-4-yl]propan-2-one |
|---|---|
| PubChem CID | 71030102 |
| Molecular Formula | C21H35N2O+ |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 1-[1,1-dimethyl-4-(4-pentylanilino)piperidin-1-ium-4-yl]propan-2-one |
| SMILES | CCCCCc1ccc(NC2(CC(C)=O)CC[N+](C)(C)CC2)cc1 |
| InChI | InChI=1S/C21H35N2O/c1-5-6-7-8-19-9-11-20(12-10-19)22-21(17-18(2)24)13-15-23(3,4)16-14-21/h9-12,22H,5-8,13-17H2,1-4H3/q+1 |
| InChIKey | KPRVESIQUVOVKT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|