C27H45N5O2S — CID 157250205
N-[1-[4-(cyclohexylcarbamothioylamino)phenyl]dodecan-5-yl]-2-hydrazinyl-2-oxoacetamide (PubChem CID 157250205) has the molecular formula C27H45N5O2S and a molecular weight of 503.76 g/mol. Its IUPAC name is N-[1-[4-(cyclohexylcarbamothioylamino)phenyl]dodecan-5-yl]-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-[1-[4-(cyclohexylcarbamothioylamino)phenyl]dodecan-5-yl]-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 157250205 |
| Molecular Formula | C27H45N5O2S |
| Molecular Weight | 503.76 g/mol |
| Exact Mass | 503.33 |
| IUPAC Name | N-[1-[4-(cyclohexylcarbamothioylamino)phenyl]dodecan-5-yl]-2-hydrazinyl-2-oxoacetamide |
| SMILES | CCCCCCCC(CCCCc1ccc(NC(=S)NC2CCCCC2)cc1)NC(=O)C(=O)NN |
| InChI | InChI=1S/C27H45N5O2S/c1-2-3-4-5-7-13-22(29-25(33)26(34)32-28)16-11-10-12-21-17-19-24(20-18-21)31-27(35)30-23-14-8-6-9-15-23/h17-20,22-23H,2-16,28H2,1H3,(H,29,33)(H,32,34)(H2,30,31,35) |
| InChIKey | AWGCOQHIHUKJDU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.76 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|