C21H33N3O3 — CID 74233887
(3S,4S)-N-(4-hexylphenyl)-3-hydroxy-4-morpholin-4-ylpyrrolidine-1-carboxamide (PubChem CID 74233887) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3S,4S)-N-(4-hexylphenyl)-3-hydroxy-4-morpholin-4-ylpyrrolidine-1-carboxamide.
| Compound Name | (3S,4S)-N-(4-hexylphenyl)-3-hydroxy-4-morpholin-4-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 74233887 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | (3S,4S)-N-(4-hexylphenyl)-3-hydroxy-4-morpholin-4-ylpyrrolidine-1-carboxamide |
| SMILES | CCCCCCc1ccc(NC(=O)N2C[C@H](O)[C@@H](N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C21H33N3O3/c1-2-3-4-5-6-17-7-9-18(10-8-17)22-21(26)24-15-19(20(25)16-24)23-11-13-27-14-12-23/h7-10,19-20,25H,2-6,11-16H2,1H3,(H,22,26)/t19-,20-/m0/s1 |
| InChIKey | YWPCEBWBTYEETQ-PMACEKPBSA-N |
| XLogP | 2.72 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|