C17H23ClN2O3 — CID 174927855
[(3S)-1-[(4-chlorophenyl)carbamoyl]pyrrolidin-3-yl] hexanoate (PubChem CID 174927855) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.83 g/mol. Its IUPAC name is [(3S)-1-[(4-chlorophenyl)carbamoyl]pyrrolidin-3-yl] hexanoate.
| Compound Name | [(3S)-1-[(4-chlorophenyl)carbamoyl]pyrrolidin-3-yl] hexanoate |
|---|---|
| PubChem CID | 174927855 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(3S)-1-[(4-chlorophenyl)carbamoyl]pyrrolidin-3-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@H]1CCN(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-2-3-4-5-16(21)23-15-10-11-20(12-15)17(22)19-14-8-6-13(18)7-9-14/h6-9,15H,2-5,10-12H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | BIIOWOYHMQDNGD-HNNXBMFYSA-N |
| XLogP | 4.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|