C21H33NO4S — CID 58145574
[4-(propan-2-ylsulfonylmethyl)cyclohexyl] N-(4-butylphenyl)carbamate (PubChem CID 58145574) has the molecular formula C21H33NO4S and a molecular weight of 395.57 g/mol. Its IUPAC name is [4-(propan-2-ylsulfonylmethyl)cyclohexyl] N-(4-butylphenyl)carbamate.
| Compound Name | [4-(propan-2-ylsulfonylmethyl)cyclohexyl] N-(4-butylphenyl)carbamate |
|---|---|
| PubChem CID | 58145574 |
| Molecular Formula | C21H33NO4S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [4-(propan-2-ylsulfonylmethyl)cyclohexyl] N-(4-butylphenyl)carbamate |
| SMILES | CCCCc1ccc(NC(=O)OC2CCC(CS(=O)(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H33NO4S/c1-4-5-6-17-7-11-19(12-8-17)22-21(23)26-20-13-9-18(10-14-20)15-27(24,25)16(2)3/h7-8,11-12,16,18,20H,4-6,9-10,13-15H2,1-3H3,(H,22,23) |
| InChIKey | QBLXNQIXWFXVMJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |