C22H36N2O3S — CID 20630466
N-(4-butylphenyl)-4-[(tert-butylsulfonylamino)methyl]cyclohexane-1-carboxamide (PubChem CID 20630466) has the molecular formula C22H36N2O3S and a molecular weight of 408.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-4-[(tert-butylsulfonylamino)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-(4-butylphenyl)-4-[(tert-butylsulfonylamino)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 20630466 |
| Molecular Formula | C22H36N2O3S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-(4-butylphenyl)-4-[(tert-butylsulfonylamino)methyl]cyclohexane-1-carboxamide |
| SMILES | CCCCc1ccc(NC(=O)C2CCC(CNS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H36N2O3S/c1-5-6-7-17-10-14-20(15-11-17)24-21(25)19-12-8-18(9-13-19)16-23-28(26,27)22(2,3)4/h10-11,14-15,18-19,23H,5-9,12-13,16H2,1-4H3,(H,24,25) |
| InChIKey | OHDZUBMBFRFWFO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |