C19H32N2O2S2 — CID 20630491
N-(4-butylphenyl)-5-(tert-butylsulfonylamino)pentanethioamide (PubChem CID 20630491) has the molecular formula C19H32N2O2S2 and a molecular weight of 384.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-5-(tert-butylsulfonylamino)pentanethioamide.
| Compound Name | N-(4-butylphenyl)-5-(tert-butylsulfonylamino)pentanethioamide |
|---|---|
| PubChem CID | 20630491 |
| Molecular Formula | C19H32N2O2S2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | N-(4-butylphenyl)-5-(tert-butylsulfonylamino)pentanethioamide |
| SMILES | CCCCc1ccc(NC(=S)CCCCNS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H32N2O2S2/c1-5-6-9-16-11-13-17(14-12-16)21-18(24)10-7-8-15-20-25(22,23)19(2,3)4/h11-14,20H,5-10,15H2,1-4H3,(H,21,24) |
| InChIKey | ABCQHICJEDAMOB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|