C18H32N2O2S — CID 70938800
N-[4-(4-butylanilino)butyl]-2-methylpropane-2-sulfonamide (PubChem CID 70938800) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is N-[4-(4-butylanilino)butyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[4-(4-butylanilino)butyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70938800 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[4-(4-butylanilino)butyl]-2-methylpropane-2-sulfonamide |
| SMILES | CCCCc1ccc(NCCCCNS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H32N2O2S/c1-5-6-9-16-10-12-17(13-11-16)19-14-7-8-15-20-23(21,22)18(2,3)4/h10-13,19-20H,5-9,14-15H2,1-4H3 |
| InChIKey | FVZBXVUVJDLXRW-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|