C22H38N2O2S — CID 59231468
N-[[4-[(4-butylanilino)methyl]cyclohexyl]methyl]-2-methylpropane-2-sulfonamide (PubChem CID 59231468) has the molecular formula C22H38N2O2S and a molecular weight of 394.63 g/mol. Its IUPAC name is N-[[4-[(4-butylanilino)methyl]cyclohexyl]methyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[[4-[(4-butylanilino)methyl]cyclohexyl]methyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 59231468 |
| Molecular Formula | C22H38N2O2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-[[4-[(4-butylanilino)methyl]cyclohexyl]methyl]-2-methylpropane-2-sulfonamide |
| SMILES | CCCCc1ccc(NCC2CCC(CNS(=O)(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H38N2O2S/c1-5-6-7-18-12-14-21(15-13-18)23-16-19-8-10-20(11-9-19)17-24-27(25,26)22(2,3)4/h12-15,19-20,23-24H,5-11,16-17H2,1-4H3 |
| InChIKey | HBXYMAPRWGBGPJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |