C19H35N3O4S — CID 70939625
N-[5-[4-[bis(2-hydroxyethyl)amino]anilino]pentyl]-2-methylpropane-2-sulfonamide (PubChem CID 70939625) has the molecular formula C19H35N3O4S and a molecular weight of 401.57 g/mol. Its IUPAC name is N-[5-[4-[bis(2-hydroxyethyl)amino]anilino]pentyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[5-[4-[bis(2-hydroxyethyl)amino]anilino]pentyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 70939625 |
| Molecular Formula | C19H35N3O4S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-[5-[4-[bis(2-hydroxyethyl)amino]anilino]pentyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCCCNc1ccc(N(CCO)CCO)cc1 |
| InChI | InChI=1S/C19H35N3O4S/c1-19(2,3)27(25,26)21-12-6-4-5-11-20-17-7-9-18(10-8-17)22(13-15-23)14-16-24/h7-10,20-21,23-24H,4-6,11-16H2,1-3H3 |
| InChIKey | VEDIXQXQLRTDAC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|